#!/usr/bin/env python3
#
# Copyright (C) 2012, 2013, 2014 Ben Elliston
# Copyright (C) 2014, 2015, 2016 The University of New South Wales
#
# This file is free software; you can redistribute it and/or modify it
# under the terms of the GNU General Public License as published by
# the Free Software Foundation; either version 3 of the License, or
# (at your option) any later version.

"""Evolutionary programming applied to NEM optimisations."""

import sys
import csv
import json
import argparse
import warnings
import numpy as np
import wx
from gooey import Gooey

from deap import algorithms
from deap import base
from deap import creator
from deap import tools
from deap import cma
try:
    from scoop import futures
except ImportError:  # pragma: no cover
    print('WARNING: scoop not loaded')

import nemo
from nemo import generators
from nemo import scenarios
from nemo import costs
from nemo import configfile as cf
from nemo import transmission

# Conversion factor between MWh and TWh.
twh = pow(10., 6)

# Ignore possible runtime warnings from SCOOP
warnings.simplefilter('ignore', RuntimeWarning)


def conditionalGooey(*pargs, **kwargs):
    """Conditional decorator that wraps the Gooey decorator if the display can be found."""
    def decorator(func):
        if not wx.PyApp.IsDisplayAvailable():  # pylint: disable=no-member
            return func
        return Gooey(*pargs, **kwargs)(func)
    return decorator


@conditionalGooey(monospaced_font=True,
                  program_name="NEMO evolution",
                  richtext_controls=True,
                  show_success_modal=False,
                  disable_progress_bar_animation=True)
def process_options():
    """Process options and return an argparse object."""
    parser = argparse.ArgumentParser(description='Bug reports via https://nemo.ozlabs.org/',
                                     add_help=False)
    comgroup = parser.add_argument_group('common', 'Commonly used options')
    costgroup = parser.add_argument_group('costs', 'Cost-related options')
    limitgroup = parser.add_argument_group('limits', 'Limits/constraints for the model')
    optgroup = parser.add_argument_group('optimiser', 'CMA-ES controls')

    comgroup.add_argument("-d", "--demand-modifier", action="append", help='demand modifier')
    comgroup.add_argument("-h", "--help", action="help", help="show this help message and exit")
    comgroup.add_argument("--list-scenarios", action="store_true", help='list supply scenarios and exit')
    comgroup.add_argument("-o", "--output", type=str, default='results.json',
                          help='output filename (will overwrite)')
    comgroup.add_argument("--reliability-std", type=float, default=0.002,
                          help='reliability standard (%% unserved)')
    comgroup.add_argument("--reserves", type=int, default=cf.get('limits', 'minimum-reserves-mw'),
                          help='minimum operating reserves [default: %s MW]' %
                          cf.get('limits', 'minimum-reserves-mw'))
    comgroup.add_argument("-s", "--supply-scenario", type=str, default='ccgt', metavar='SCENARIO',
                          choices=sorted(scenarios.supply_scenarios),
                          help='generation mix scenario [default: ccgt]')
    comgroup.add_argument("-t", "--transmission", action="store_true", help="include transmission [default: False]")

    costgroup.add_argument("-c", "--carbon-price", type=int,
                           default=cf.get('costs', 'co2-price-per-t'),
                           help='carbon price ($/t) [default: %s]' % cf.get('costs', 'co2-price-per-t'))
    costgroup.add_argument("--costs", type=str, metavar='cost_class',
                           default=cf.get('costs', 'technology-cost-class'),
                           choices=sorted(costs.cost_scenarios),
                           help='technology cost class [default: %s]' % cf.get('costs', 'technology-cost-class'))
    costgroup.add_argument("--ccs-storage-costs", type=float, default=cf.get('costs', 'ccs-storage-costs-per-t'),
                           help='CCS storage costs ($/t) [default: %s]' % cf.get('costs', 'ccs-storage-costs-per-t'))
    costgroup.add_argument("--coal-price", type=float, default=cf.get('costs', 'coal-price-per-gj'),
                           help='black coal price ($/GJ) [default: %s]' % cf.get('costs', 'coal-price-per-gj'))
    costgroup.add_argument("--gas-price", type=float, default=cf.get('costs', 'gas-price-per-gj'),
                           help='gas price ($/GJ) [default: %s]' % cf.get('costs', 'gas-price-per-gj'))
    costgroup.add_argument("-r", "--discount-rate", type=float, default=cf.get('costs', 'discount-rate'),
                           help='discount rate [default: %s]' % cf.get('costs', 'discount-rate'))

    limitgroup.add_argument("--bioenergy-limit", type=float, default=cf.get('limits', 'bioenergy-twh-per-yr'),
                            help='Limit on annual energy from bioenergy (TWh/y) [default: %s]' %
                            cf.get('limits', 'bioenergy-twh-per-yr'))
    limitgroup.add_argument("--emissions-limit", type=float, default=np.inf,
                            help='CO2 emissions limit (Mt/y) [default: infinity]')
    limitgroup.add_argument("--fossil-limit", type=float, default=1.0,
                            help='Maximum share of energy from fossil fuel [default: 1.0]')
    limitgroup.add_argument("--hydro-limit", type=float, default=cf.get('limits', 'hydro-twh-per-yr'),
                            help='Limit on annual energy from hydro (TWh/y) [default: %s]' %
                            cf.get('limits', 'hydro-twh-per-yr'))
    limitgroup.add_argument("--min-regional-generation", type=float, default=0.0,
                            help='minimum share of energy generated intra-region [default: 0]')
    limitgroup.add_argument("--nsp-limit", type=float, default=cf.get('limits', 'nonsync-penetration'),
                            help='Non-synchronous penetration limit [default: %s]' %
                            cf.get('limits', 'nonsync-penetration'))

    optgroup.add_argument("--lambda", type=int, dest='lambda_', help='override CMA-ES lambda value')
    optgroup.add_argument("--seed", type=int, help='seed for random number generator')
    optgroup.add_argument("--sigma", type=float, default=cf.get('optimiser', 'sigma'),
                          help='CMA-ES sigma value [default: %s]' % cf.get('optimiser', 'sigma'))
    optgroup.add_argument("-g", "--generations", type=int, default=cf.get('optimiser', 'generations'),
                          help='generations [default: %s]' % cf.get('optimiser', 'generations'))
    optgroup.add_argument("--trace-file", type=str, help='Filename for evaluation trace (CSV format)')
    optgroup.add_argument("-v", "--verbose", action="store_true", help="be verbose")
    return parser.parse_args()


def setup_context():
    """Set up the context object based on command line arguments."""
    ctx = nemo.Context()
    ctx.relstd = args.reliability_std

    # Set the system non-synchronous penetration limit.
    ctx.nsp_limit = args.nsp_limit
    assert 0 <= ctx.nsp_limit <= 1

    # Likewise for the minimum share of regional generation.
    ctx.min_regional_generation = args.min_regional_generation
    assert 0 <= ctx.min_regional_generation <= 1, \
        "Minimum regional generation must be in the interval [0,1]"

    cost_class = costs.cost_scenarios[args.costs]
    ctx.costs = cost_class(args.discount_rate, args.coal_price, args.gas_price, args.ccs_storage_costs)
    ctx.costs.carbon = args.carbon_price
    ctx.costs.transmission = transmission.Transmission(costs.txcost, args.discount_rate)
    ctx.track_exchanges = args.transmission
    return ctx


def list_scenarios():
    """Print out a list of the scenarios with a description."""
    for key in sorted(scenarios.supply_scenarios):
        descr = scenarios.supply_scenarios[key].__doc__
        print('%20s' % key, '\t', descr.split('\n')[0])
    print()
    sys.exit(0)


args = process_options()

if __name__ == '__main__' and args.list_scenarios:
    list_scenarios()

if __name__ == '__main__':
    print(vars(args))

context = setup_context()

# Set up the scenario.
scenarios.supply_scenarios[args.supply_scenario](context)

# Apply each demand modifier argument (if any) in the given order.
for arg in args.demand_modifier or []:
    scenarios.demand_switch(arg)(context)

if args.verbose and __name__ == '__main__':
    docstring = scenarios.supply_scenarios[args.supply_scenario].__doc__
    assert docstring is not None
    # Prune off any doctest test from the docstring.
    docstring = docstring.split('\n')[0]
    print("supply scenario: %s (%s)" % (args.supply_scenario, docstring))
    print(context.generators)

if args.trace_file is not None:
    with open(args.trace_file, 'w') as csvfile:
        writer = csv.writer(csvfile)
        writer.writerow(['# score', 'penalty', 'reasoncode', 'parameter values'])

reasons = {'unserved': 1, 'emissions': 2, 'fossil': 4, 'bioenergy': 8,
           'hydro': 16, 'reserves': 32, 'min-regional-gen': 64}


def _penalty_unserved(ctx):
    """Penalty: unserved energy"""
    minuse = ctx.total_demand() * (ctx.relstd / 100)
    use = max(0, ctx.unserved_energy() - minuse)
    reason = reasons['unserved'] if use > 0 else 0
    return pow(use, 3), reason


def _penalty_reserves(ctx):
    """Penalty: minimum reserves"""
    pen, reas = 0, 0
    for i in range(ctx.timesteps):
        reserve, spilled = 0, 0
        for g in ctx.generators:
            try:
                spilled += g.series_spilled[i]
            except KeyError:
                # non-variable generators may not have spill data
                pass

            # Calculate headroom for each generator, except pumped hydro and
            # CST -- tricky to calculate capacity
            if isinstance(g, nemo.generators.Fuelled) and not \
               isinstance(g, nemo.generators.PumpedHydro) and not \
               isinstance(g, nemo.generators.CST):
                reserve += g.capacity - g.series_power[i]

        if reserve + spilled < args.reserves:
            reas |= reasons['reserves']
            pen += pow(args.reserves - reserve + spilled, 3)
    return pen, reas


def _penalty_min_regional(ctx):
    """Penalty: minimum share of regional generation"""
    regional_generation_shortfall = 0
    for rgn in ctx.regions:
        regional_demand = 0
        for poly in rgn.polygons:
            regional_demand += ctx.demand[poly - 1].sum()
        regional_generation = 0
        for g in ctx.generators:
            if g.region() is rgn:
                regional_generation += sum(g.series_power.values())
        min_regional_generation = regional_demand * ctx.min_regional_generation
        regional_generation_shortfall += max(0, min_regional_generation - regional_generation)
    reason = reasons['min-regional-gen'] if regional_generation_shortfall > 0 else 0
    return pow(regional_generation_shortfall, 3), reason


def _penalty_emissions(ctx):
    """Penalty: total emissions"""
    emissions = 0
    for g in ctx.generators:
        if hasattr(g, 'intensity'):
            emissions += sum(g.series_power.values()) * g.intensity
    # exceedance in tonnes CO2-e
    emissions_exceedance = max(0, emissions - args.emissions_limit * pow(10, 6) * ctx.years)
    reason = reasons['emissions'] if emissions_exceedance > 0 else 0
    return pow(emissions_exceedance, 3), reason


def _penalty_fossil(ctx):
    """Penalty: limit fossil to fraction of annual demand"""
    fossil_energy = 0
    for g in ctx.generators:
        if isinstance(g, generators.Fossil):
            fossil_energy += sum(g.series_power.values())
    fossil_exceedance = max(0, fossil_energy - ctx.total_demand() * args.fossil_limit * ctx.years)
    reason = reasons['fossil'] if fossil_exceedance > 0 else 0
    return pow(fossil_exceedance, 3), reason


def _penalty_bioenergy(ctx):
    """Penalty: limit biofuel use"""
    biofuel_energy = 0
    for g in ctx.generators:
        if isinstance(g, generators.Biofuel):
            biofuel_energy += sum(g.series_power.values())
    biofuel_exceedance = max(0, biofuel_energy - args.bioenergy_limit * twh * ctx.years)
    reason = reasons['bioenergy'] if biofuel_exceedance > 0 else 0
    return pow(biofuel_exceedance, 3), reason


def _penalty_hydro(ctx):
    """Penalty: limit hydro use"""
    hydro_energy = 0
    for g in ctx.generators:
        if isinstance(g, generators.Hydro) and \
           not isinstance(g, generators.PumpedHydro):
            hydro_energy += sum(g.series_power.values())
    hydro_exceedance = max(0, hydro_energy - args.hydro_limit * twh * ctx.years)
    reason = reasons['hydro'] if hydro_exceedance > 0 else 0
    return pow(hydro_exceedance, 3), reason


# Build list of penalty functions based on command line args, etc.
penaltyfns = [_penalty_unserved, _penalty_bioenergy, _penalty_hydro]
if args.reserves > 0:
    penaltyfns.append(_penalty_reserves)
if args.emissions_limit < np.inf:
    penaltyfns.append(_penalty_emissions)
if args.fossil_limit < 1:
    penaltyfns.append(_penalty_fossil)
if context.min_regional_generation > 0:
    penaltyfns.append(_penalty_min_regional)


def cost(ctx):
    """Sum up the costs."""
    score = 0
    for g in ctx.generators:
        score += (g.capcost(ctx.costs) / ctx.costs.annuityf * ctx.years) \
            + g.opcost(ctx.costs)

    # Run through all of the penalty functions.
    penalty, reason = 0, 0
    for penaltyfn in penaltyfns:
        p, r = penaltyfn(ctx)
        penalty += p
        reason |= r

    if args.transmission:
        maxexchanges = ctx.exchanges.max(axis=0)
        np.fill_diagonal(maxexchanges, 0)
        for i in range(1, maxexchanges.shape[0]):
            # then put the max (upper, lower) into lower
            # and zero the upper entries
            for j in range(i):
                maxexchanges[i, j] = max(maxexchanges[i, j], maxexchanges[j, i])
                maxexchanges[j, i] = 0
        try:
            # existing transmission is "free"
            maxexchanges = np.maximum(0, maxexchanges - nemo.polyons.existing_net)
        except AttributeError:
            # skip if not present
            pass

        costmat = ctx.costs.transmission.cost_matrix(maxexchanges) * ctx.years
        score += costmat.sum()

    score /= ctx.total_demand()
    penalty /= ctx.total_demand()
    # Express $/yr as an average $/MWh over the period
    return score, penalty, reason


def eval_func(chromosome):
    """Average cost of energy (in $/MWh)."""
    context.set_capacities(chromosome)
    nemo.run(context)
    score, penalty, reason = cost(context)
    if args.trace_file is not None:
        # write the score and individual to the trace file
        with open(args.trace_file, 'a') as tracefile:
            tracer = csv.writer(tracefile)
            tracer.writerow([score, penalty, reason] + list(chromosome))
    return (score + penalty,)


creator.create("FitnessMin", base.Fitness, weights=(-1.0,))
creator.create("Individual", list, fitness=creator.FitnessMin)  # pylint: disable=no-member
toolbox = base.Toolbox()
try:
    toolbox.register("map", futures.map)
except NameError:  # pragma: no cover
    pass

# See:
# https://deap.readthedocs.org/en/master/api/algo.html#deap.cma.Strategy
# for additional parameters that can be passed to cma.Strategy.
numparams = sum(list(len(g.setters) for g in context.generators))
if args.lambda_ is None:
    # let DEAP choose
    strategy = cma.Strategy(centroid=[0] * numparams, sigma=args.sigma)
else:
    strategy = cma.Strategy(centroid=[0] * numparams, sigma=args.sigma, lambda_=args.lambda_)

toolbox.register("generate", strategy.generate, creator.Individual)  # pylint: disable=no-member
toolbox.register("update", strategy.update)
toolbox.register("evaluate", eval_func)


def run():
    """Run the evolution."""
    if args.verbose and __name__ == '__main__':
        print("objective: minimise", eval_func.__doc__)

    np.random.seed(args.seed)
    hof = tools.HallOfFame(1)
    stats_fit = tools.Statistics(lambda ind: ind.fitness.values)
    stats_hof = tools.Statistics(lambda ignored: hof[0].fitness.values)
    mstats = tools.MultiStatistics(fitness=stats_fit, hallfame=stats_hof)
    mstats.register("min", np.min)

    try:
        algorithms.eaGenerateUpdate(toolbox, ngen=args.generations,
                                    stats=mstats, halloffame=hof, verbose=True)
    except KeyboardInterrupt:  # pragma: no cover
        print('user terminated early')

    context.set_capacities(hof[0])
    nemo.run(context)
    context.verbose = True
    print()
    print(context)
    score, penalty, reason = cost(context)
    print('Score: %.2f $/MWh' % score)
    constraints_violated = []
    if reason > 0:
        print('Penalty: %.2f $/MWh' % penalty)
        print('Constraints violated:', end=' ')
        for label, code in reasons.items():
            if reason & code:
                constraints_violated += [label]
                print(label, end=' ')
        print()
    if args.transmission:
        np.set_printoptions(precision=5)
        x = context.exchanges.max(axis=0)
        print(np.array_str(x, precision=1, suppress_small=True))
        obj = {'exchanges': x.tolist(), 'generators': context}
        with open('results.json', 'w') as f:
            json.dump(obj, f, cls=nemo.Context.JSONEncoder, indent=True)

    with open(args.output, 'w') as f:
        bundle = {'options': vars(args),
                  'parameters': [max(0, cap) for cap in hof[0]],
                  'score': score, 'penalty': penalty,
                  'constraints_violated': constraints_violated}
        json.dump(bundle, f)
    print('Done')


if __name__ == '__main__':
    run()
